| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 11α-Hydroxyandrost-4-ene-317-dione Basic information |
| Product Name: | 11α-Hydroxyandrost-4-ene-317-dione | | Synonyms: | 4-ANDROSTEN-11-ALPHA-OL-3,17-DIONE;11A-HYDROXYANDROST-4-ENE-3,17-DIONE;11ALPHA-HYDROXYANDROST-4-ENE-3,17-DIONE;11-ALPHA-HYDROXYANDROSTENEDIONE;11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-quinone;(1R,2R,10R,11S,15S)-3-hydroxy-2,15-diMethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-ene-5,14-dione;(8S,9S,10R,11R,13S,14S)-11-hydroxy-10,13-dimethyl-7,8,9,10,11,12,13,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17(2H,6H)-dione;11-Hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione | | CAS: | 564-33-0 | | MF: | C19H26O3 | | MW: | 302.41 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 564-33-0.mol |  |
| | 11α-Hydroxyandrost-4-ene-317-dione Chemical Properties |
| Melting point | 226-227 °C | | Boiling point | 475.3±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.49±0.60(Predicted) | | color | Light Yellow to Orange | | InChI | InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14-,15+,17+,18-,19-/m0/s1 | | InChIKey | WSCUHXPGYUMQEX-GBHAUCNQSA-N | | SMILES | C[C@]12CCC(=O)C=C1CC[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)C[C@@H](O)[C@]21[H] | | CAS DataBase Reference | 564-33-0 |
| | 11α-Hydroxyandrost-4-ene-317-dione Usage And Synthesis |
| Uses | 11b-Hydroxyandrost-4-ene-3,17-dione is an intermediate in the synthesis o formebolone (F685300), which is a anbolic steroid. | | Definition | ChEBI: 11b-Hydroxyandrost-4-ene-3,17-dione is a 3-hydroxy steroid. It has a role as an androgen. |
| | 11α-Hydroxyandrost-4-ene-317-dione Preparation Products And Raw materials |
| Raw materials | (11α)-11-Hydroxyandrost-5-ene-3,17-dione Cyclic Bis(1,2-ethanediyl Acetal)-->Androst-5-ene-3,11,17-trione, Cyclic 3,17-Bis(1,2-ethanediyl acetal)-->Adrenosterone-->6α-Hydroxy-androst-4-ene-3,17-dione-->11-alpha-Hydrocortisone-->Androstenedione-->Succinic anhydride | | Preparation Products | 5α-Androstane-3,6,17-trione |
|