| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- 11-Epicortisol
-
- $9.80
-
2020-01-03
- CAS:566-35-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | 11-ALPHA-HYDROCORTISONE Basic information |
| Product Name: | 11-ALPHA-HYDROCORTISONE | | Synonyms: | Pregn-4-ene-11,17,21-triol-3,20-dione;Hydrocortisone Impurity 13(Hydrocortisone EP Impurity M);EPI COMPOUND ''F'';EPI COMPOUND 'F';11-EPICORTISOL;11-ALPHA-HYDROCORTISONE;4-PREGNEN-11-ALPHA, 17,21-TRIOL-3,20-DIONE;4-PREGNEN-11ALPHA,17ALPHA,21-TETROL-3,20-DIONE | | CAS: | 566-35-8 | | MF: | C21H30O5 | | MW: | 362.46 | | EINECS: | | | Product Categories: | | | Mol File: | 566-35-8.mol |  |
| | 11-ALPHA-HYDROCORTISONE Chemical Properties |
| Melting point | 217-219 °C | | Boiling point | 566.4±50.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.47±0.70(Predicted) | | color | White to Off-White | | InChIKey | JYGXADMDTFJGBT-RPEWHVAONA-N | | SMILES | [C@@]12([H])CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@@H](O)[C@]1([H])[C@@]3(C)CCC(=O)C=C3CC[C@@]21[H] |&1:0,4,10,13,15,17,27,r| |
| | 11-ALPHA-HYDROCORTISONE Usage And Synthesis |
| Chemical Properties | Crystalline compound. Melting point 217-220°C (partially decomposed). Soluble in ethanol, methanol, and acetone, slightly soluble in chloroform, and slightly soluble in water and ether. | | Uses | 11-Epihydrocortisone is an isomer of Hydrocortisone (H714615), a glucocorticord which functions primarily to increase blood sugar through gluconeogenesis, suppression of immune system and aid in fat,
protein and carbohydrate metabolism. | | Uses | 11-Epihydrocortisone (Hydrocortisone EP Impurity M) is an isomer of Hydrocortisone (H714615), a glucocorticord which functions primarily to increase blood sugar through gluconeogenesis, suppression of immune system and aid in fat, protein and carbohydrate metabolism. | | Definition | ChEBI: 11alpha-Hydrocortisone is a 21-hydroxy steroid. |
| | 11-ALPHA-HYDROCORTISONE Preparation Products And Raw materials |
|