- 2-Dodecanol
-
- $0.00 / 50mg
-
2026-03-12
- CAS:10203-28-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 2-DODECANOL Basic information |
| | 2-DODECANOL Chemical Properties |
| Melting point | 19 °C | | Boiling point | 249-250 °C (lit.) | | density | 0.829 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.44(lit.) | | Fp | >230 °F | | form | powder to lump to clear liquid | | pka | 15.27±0.20(Predicted) | | color | White or Colorless to Almost white or Almost colorless | | BRN | 1720036 | | InChI | InChI=1S/C12H26O/c1-3-4-5-6-7-8-9-10-11-12(2)13/h12-13H,3-11H2,1-2H3 | | InChIKey | XSWSEQPWKOWORN-UHFFFAOYSA-N | | SMILES | CC(O)CCCCCCCCCC | | LogP | 4.759 (est) | | CAS DataBase Reference | 10203-28-8(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29051900 | | Storage Class | 10 - Combustible liquids |
| | 2-DODECANOL Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2-Dodecanol inhibits hyphal formation and SIR2 expression in C. albicans[1]. | | Synthesis Reference(s) | Tetrahedron, 50, p. 8539, 1994 DOI: 10.1016/S0040-4020(01)85572-1 | | References | [1] Lim CS, et al. 2-dodecanol (decyl methyl carbinol) inhibits hyphal formation and SIR2 expression in C. albicans. J Basic Microbiol. 2009 Dec;49(6):579-83. DOI:10.1002/jobm.200900035 |
| | 2-DODECANOL Preparation Products And Raw materials |
|