| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole Basic information |
| Product Name: | 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole | | Synonyms: | 4,5,6,7-Tetrahydro-2,3-Benzothiazole Diamine;2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole;4,5,6,7-TETRAHYDRO-1,3-BENZOTHIAZOL-2,6-DIAMINE;4,5,6,7-tetrahydro-2,6-benzothiazole diamine;6-DiaMino-4;7-tetrahydrobenzothiazole;4,5,6,7-Tetrahydro-benzothiazole-2,6-diaMine;(RS)-N-Despropyl PraMipexole | | CAS: | 104617-49-4 | | MF: | C7H11N3S | | MW: | 169.25 | | EINECS: | 600-587-9 | | Product Categories: | Amines | | Mol File: | 104617-49-4.mol |  |
| | 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole Chemical Properties |
| Melting point | >180oC (dec.) | | Boiling point | 359.0±42.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | vapor pressure | 0-0Pa at 20-50℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Methanol (Slightly) | | pka | 9.18±0.20(Predicted) | | form | Solid | | color | White to Pale Brown | | InChI | InChI=1S/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10) | | InChIKey | DRRYZHHKWSHHFT-UHFFFAOYSA-N | | SMILES | NC1SC2CC(N)CCC=2N=1 | | LogP | -0.2 at 20℃ and pH9.24 | | Surface tension | 71.2mN/m at 1g/L and 20℃ | | CAS DataBase Reference | 104617-49-4(CAS DataBase Reference) |
| | 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole Usage And Synthesis |
| Uses | (RS)-N-Despropyl Pramipexole is an intermediate in the synthesis of Pramipexole (P700755), a dopamine-D2-receptor agonist; an antiparkinsonian agent. |
| | 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole Preparation Products And Raw materials |
|