|
|
| | 1-Deoxy-1-morpholino-D-fructose Basic information |
| Product Name: | 1-Deoxy-1-morpholino-D-fructose | | Synonyms: | 1-deoxy-1-morpholinofructose;D-Fructose,1-deoxy-1-(4-morpholinyl)- (9CI);(3S,4R,5R)-3,4,5,6-Tetrahydroxy-1-morpholinohexan-2-one;D-Fructose, 1-deoxy-1-(4-morpholinyl)-;(3S,4R,5R)-3,4,5,6-Tetrahydroxy-1-morpholino-2-hexanone;1-Deoxy-1-morpholino-D-fructose;1-Deoxy-1-morpholino-D-fructose | | CAS: | 6291-16-3 | | MF: | C10H19NO6 | | MW: | 249.26 | | EINECS: | | | Product Categories: | Carbohydrates;Carbohydrates A to;Carbohydrates D-FBiochemicals and Reagents;Monosaccharide | | Mol File: | 6291-16-3.mol |  |
| | 1-Deoxy-1-morpholino-D-fructose Chemical Properties |
| Melting point | 147-150 °C | | Boiling point | 538.4±50.0 °C(Predicted) | | density | 1.381±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | pyridine: 50 mg/mL, clear, faintly yellow | | pka | 12.06±0.20(Predicted) | | form | powder | | color | white to off-white | | BRN | 19582 | | InChI | InChI=1/C10H19NO6/c12-6-8(14)10(16)9(15)7(13)5-11-1-3-17-4-2-11/h8-10,12,14-16H,1-6H2/t8-,9-,10-/s3 | | InChIKey | JPANQHVKLYKLEB-UTCZLQSGNA-N | | SMILES | N1(CCOCC1)CC(=O)[C@@H](O)[C@H](O)[C@H](O)CO |&1:9,11,13,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 1-Deoxy-1-morpholino-D-fructose Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | DMF (1-Deoxy-1-morpholino-D-fructose), an analog of the 1-desoxy-1-amino-fructose radical found in glycated proteins, is used in the development of glycation assays. |
| | 1-Deoxy-1-morpholino-D-fructose Preparation Products And Raw materials |
|