- Boc-L-Pro-OL
-
-
2026-08-21
- CAS:69610-40-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- BOC-L-Prolinol
-
-
2026-08-21
- CAS:69610-40-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- N-Boc-L-Prolinol
-
- $1.10
-
2026-08-20
- CAS:69610-40-8
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 100KG
|
| | BOC-L-Prolinol Basic information |
| | BOC-L-Prolinol Chemical Properties |
| Melting point | 62-64 °C (lit.) | | Boiling point | 150 °C / 4mmHg | | alpha | -52 º (c=1, CHCl3) | | density | 1.0948 (rough estimate) | | refractive index | -55 ° (C=5, MeOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 14.77±0.10(Predicted) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]21/D 48°, c = 1.3 in chloroform | | Water Solubility | insoluble | | BRN | 3542667 | | Major Application | peptide synthesis | | InChI | 1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h8,12H,4-7H2,1-3H3/t8-/m0/s1 | | InChIKey | BFFLLBPMZCIGRM-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO | | CAS DataBase Reference | 69610-40-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-Prolinol Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Building block for novel nicotinic acetylcholine receptor ligands with cognition-enhancing properties. Used in the synthesis of chiral β-amino sulfides and β-amino thiols. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-Prolinol Preparation Products And Raw materials |
|