| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2,6-Dichloro-3-nitrotoluene manufacturers
|
| | 2,6-Dichloro-3-nitrotoluene Basic information |
| Product Name: | 2,6-Dichloro-3-nitrotoluene | | Synonyms: | Benzene, 1,3-dichloro-2-methyl-4-nitro-;2,6-DICHLORO-3-NITROTOLUENE, 99% ** SEE;2,4-dichloro-3-methylnitrobenzene;1,3-DICHLORO-2-METHYL-4-NITROBENZENE;2,6-Dichloro-3-nitrotoluene,99%;NSC 102503;2,6-Dichloro-3-nitrotoluene>1,3-Dichloro-2-methyl-4-nitrobenzene - [D94407] | | CAS: | 29682-46-0 | | MF: | C7H5Cl2NO2 | | MW: | 206.03 | | EINECS: | 249-776-4 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives;Halogen toluene;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 29682-46-0.mol |  |
| | 2,6-Dichloro-3-nitrotoluene Chemical Properties |
| Melting point | 53-56 °C (lit.) | | Boiling point | 293.8±35.0 °C(Predicted) | | density | 1.4062 (rough estimate) | | refractive index | 1.6100 (estimate) | | Fp | >230 °F | | storage temp. | Store at room temperature | | form | powder to crystal | | color | Light orange to Yellow to Green | | Water Solubility | Insoluble in water. | | BRN | 2259855 | | InChI | 1S/C7H5Cl2NO2/c1-4-5(8)2-3-6(7(4)9)10(11)12/h2-3H,1H3 | | InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N | | SMILES | Cc1c(Cl)ccc(c1Cl)[N+]([O-])=O | | CAS DataBase Reference | 29682-46-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29049095 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Dichloro-3-nitrotoluene Usage And Synthesis |
| Chemical Properties | light yellow to light green solid | | Uses | 2,6-Dichloro-3-nitrotoluene, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 2,6-Dichloro-3-nitrotoluene Preparation Products And Raw materials |
|