|
|
| | 4,4'-Difluorodiphenylmethylchloride Basic information |
| Product Name: | 4,4'-Difluorodiphenylmethylchloride | | Synonyms: | 1,1'-(CHLOROMETHYLENE)BIS(4-FLUOROBENZENE);BIS(4-FLUOROPHENYL)CHLOROMETHANE;CHLOROBIS(4-FLUOROPHENYL)METHANE;4,4'-Difluorobenzhydryl chloride, technical grade;Chlorobis(p-fluorophenyl)methane;4,4'-Difluorobenzhydrylchloride,98%;Bis(p-Fluorophenyl)chlorometha;4,4'-Difluorobenzhydryl chloride 98% | | CAS: | 27064-94-4 | | MF: | C13H9ClF2 | | MW: | 238.66 | | EINECS: | 248-201-4 | | Product Categories: | | | Mol File: | 27064-94-4.mol |  |
| | 4,4'-Difluorodiphenylmethylchloride Chemical Properties |
| Boiling point | 126-128 °C1 mm Hg(lit.) | | density | 1.28 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.557(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | form | Liquid | | color | Clear colorless to slightly yellow | | Sensitive | Moisture Sensitive | | BRN | 2052680 | | InChI | InChI=1S/C13H9ClF2/c14-13(9-1-5-11(15)6-2-9)10-3-7-12(16)8-4-10/h1-8,13H | | InChIKey | FHPNLCLHMNPLEW-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)Cl | | CAS DataBase Reference | 27064-94-4(CAS DataBase Reference) |
| | 4,4'-Difluorodiphenylmethylchloride Usage And Synthesis |
| Chemical Properties | clear colourless to slightly yellow liquid | | Uses | Chlorobis(4-fluorophenyl)methane is a compound involved in the synthesis of 1-[bis(4-fluorophenyl)methyl]-4-cinnamylpiperazine, a T-type calcium channel blocker and anti-ischemic drug. |
| | 4,4'-Difluorodiphenylmethylchloride Preparation Products And Raw materials |
|