|
|
| | 4-FLUORODIPHENYLMETHANE Basic information | | Uses |
| Product Name: | 4-FLUORODIPHENYLMETHANE | | Synonyms: | 4-FluorodiphenylmethaneDISC 05/09/02 see # 9194;1-Benzyl-4-fluorobenzene;4-FLUORODIPHENYLMETHANE;4-Fluorodiphenylmethane 99%;4-Fluorodiphenylmethane99%;4-Fluorodiphenylmethane>;Benzene, 1-fluoro-4-(phenylmethyl)- | | CAS: | 587-79-1 | | MF: | C13H11F | | MW: | 186.22 | | EINECS: | | | Product Categories: | | | Mol File: | 587-79-1.mol |  |
| | 4-FLUORODIPHENYLMETHANE Chemical Properties |
| Boiling point | 94°C 1mm | | density | 1 | | refractive index | 1.5540 to 1.5580 | | form | clear liquid | | Specific Gravity | 1.0 | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C13H11F/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2 | | InChIKey | ADCBAIUWZPOIMC-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(CC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 587-79-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2942000090 |
| | 4-FLUORODIPHENYLMETHANE Usage And Synthesis |
| Uses | 4-Fluorodiphenylmethane is a hydrocarbon halide, mainly used in organic synthesis and experimental research. |
| | 4-FLUORODIPHENYLMETHANE Preparation Products And Raw materials |
|