| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate Basic information |
| Product Name: | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate | | Synonyms: | 1,3,(6 OR 7)-NAPHTHALENETRISULFONIC ACID, TRISODIUM SALT HYDRATE;NAPHTHALENE-1,3,6-TRISULFONIC ACID, NA, HYDRATE;NAPHTHALENE-1,3,6-TRISULFONIC ACID TRISODIUM SALT;NAPHTHALENE-1,3,6-TRISULFONIC ACID TRISODIUM SALT HYDRATE;TRISODIUM NAPHTHALENE-1,3,6-TRISULFONATE HYDRATE;trisodium naphthalene-2,3,6-trisulfonate hydrate;1,3,(6 or 7)-naphthalenetrisulfonic acid;Naphthalene-1,3,6-trisulfonic acid hydrate trisodium salt | | CAS: | 123409-01-8 | | MF: | C10H7Na3O10S3 | | MW: | 452.32 | | EINECS: | 681-215-2 | | Product Categories: | Building Blocks;Chemical Synthesis;Organic Building Blocks;Sulfonic/Sulfinic Acids;Sulfur Compounds;Organic Building Blocks;Sulfonic/Sulfinic Acids;Sulfur Compounds | | Mol File: | 123409-01-8.mol |  |
| | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate Chemical Properties |
| form | Powder | | color | White to light yellow or beige | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C10H8O9S3/c11-20(12,13)7-1-2-9-6(3-7)4-8(21(14,15)16)5-10(9)22(17,18)19/h1-5H,(H,11,12,13)(H,14,15,16)(H,17,18,19) | | InChIKey | ZPBSAMLXSQCSOX-UHFFFAOYSA-N | | SMILES | C12C=CC(S(=O)(=O)O)=CC1=CC(S(=O)(=O)O)=CC=2S(=O)(=O)O | | CAS DataBase Reference | 123409-01-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 38-36/37/38 | | Safety Statements | 22-24/25-26 | | WGK Germany | 3 | | TSCA | Yes | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate Usage And Synthesis |
| Uses | Naphthalene-1,3,6-trisulfonic acid trisodium salt hydrate is used as an anionic chromophore. | | Application | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate can be used as: An anionic chromophore in capillary electrophoresis. An anionic dopant for the polymerization of pyrrole. | | General Description | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate is an anionic chromophore. |
| | 1,3,(6,7)-Naphthalenetrisulfonic acid trisodium salt hydrate Preparation Products And Raw materials |
|