| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
3-Cyclohexyl-L-alanine hydrate manufacturers
- L-CHA-OH Hydrate
-
-
2026-09-11
- CAS:307310-72-1
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 1000kg
|
| | 3-Cyclohexyl-L-alanine hydrate Basic information |
| Product Name: | 3-Cyclohexyl-L-alanine hydrate | | Synonyms: | (s)-(+)-α-aminocyclohexanepropionic acid hydrate;Cyclohexanepropanoicacid, a-amino-, hydrate (1:1), (aS)-;(2S)-2-amino-3-cyclohexylpropanoic acid,hydrate;(alphaS)-alpha-Aminocyclohexanepropanoic acid monohydrate;(S)-2-Amino-3-cyclohexylpropanoic acid hydrate;L-CHA-OH Hydrate;(S)-(+)-ALPHA-AMINOCYCLOHEXANEPROPIO;(S)-2-AMINO-3-CYCLOHEXYLPROPIONIC ACID HYDRATE | | CAS: | 307310-72-1 | | MF: | C9H19NO3 | | MW: | 189.25 | | EINECS: | | | Product Categories: | | | Mol File: | 307310-72-1.mol |  |
| | 3-Cyclohexyl-L-alanine hydrate Chemical Properties |
| Melting point | 234-237 °C (lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]21/D +12.0°, c = 1 in 1 M NaOH | | Major Application | peptide synthesis | | InChI | 1S/C9H17NO2.H2O/c10-8(9(11)12)6-7-4-2-1-3-5-7;/h7-8H,1-6,10H2,(H,11,12);1H2/t8-;/m0./s1 | | InChIKey | HDJQIWAIDCEDEF-QRPNPIFTSA-N | | SMILES | [H]O[H].N[C@@H](CC1CCCCC1)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 3-Cyclohexyl-L-alanine hydrate Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | 3-Cyclohexyl-L-alanine hydrate Preparation Products And Raw materials |
|