- FMOC-CHA-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:135673-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- FMOC-CHA-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:135673-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- FMOC-CHA-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:135673-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-CHA-OH Basic information |
| | FMOC-CHA-OH Chemical Properties |
| Melting point | 125-130°C | | Boiling point | 517.93°C (rough estimate) | | density | 1.1836 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Dimethylformamide | | form | Solid | | pka | 3.91±0.10(Predicted) | | color | White to Almost white | | BRN | 7052264 | | Major Application | peptide synthesis | | InChIKey | HIJAUEZBPWTKIV-ZEGQKUPANA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2CCCCC2)C2=CC=CC=C2C2=CC=CC=C12 |&1:6,r| |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-35-44-28-7-4 | | WGK Germany | 3 | | F | 10 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | FMOC-CHA-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-Cha-OH, | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-CHA-OH Preparation Products And Raw materials |
|