|
|
| | 2-(5-Nitro-2-pyridyloxy)ethanol Basic information |
| Product Name: | 2-(5-Nitro-2-pyridyloxy)ethanol | | Synonyms: | 2-[(5-NITRO-2-PYRIDYL)OXY]ETHAN-1-OL;2-(5-NITRO-2-PYRIDYLOXY)ETHANOL;2-[(5-NITRO-2-PYRIDYL)THIO]ETHAN-1-OL;2-(2-Hydroxyethoxy)-5-nitropyridine;2-(5-Nitropyridin-2-yloxy)ethanol;2-[(5-Nitropyridin-2-yl)oxy]ethan-1-ol;2-(5-Nitro-2-pyridyloxy)ethanol, 98%,;Ethanol, 2-[(5-nitro-2-pyridinyl)oxy]- | | CAS: | 143071-39-0 | | MF: | C7H8N2O4 | | MW: | 184.15 | | EINECS: | 640-278-6 | | Product Categories: | | | Mol File: | 143071-39-0.mol |  |
| | 2-(5-Nitro-2-pyridyloxy)ethanol Chemical Properties |
| Melting point | 112-114°C | | Boiling point | 355.7±27.0 °C(Predicted) | | density | 1.389±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.97±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 150856 | | InChI | InChI=1S/C7H8N2O4/c10-3-4-13-7-2-1-6(5-8-7)9(11)12/h1-2,5,10H,3-4H2 | | InChIKey | KESQFSZFUCZCEI-UHFFFAOYSA-N | | SMILES | C(O)COC1=NC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 143071-39-0 |
| Safety Statements | 22-24/25 | | HS Code | 2933399990 |
| Provider | Language |
|
ALFA
| English |
| | 2-(5-Nitro-2-pyridyloxy)ethanol Usage And Synthesis |
| | 2-(5-Nitro-2-pyridyloxy)ethanol Preparation Products And Raw materials |
|