| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
Benzeneacetonitrile, 4-amino-α-ethyl- manufacturers
|
| | Benzeneacetonitrile, 4-amino-α-ethyl- Basic information |
| Product Name: | Benzeneacetonitrile, 4-amino-α-ethyl- | | Synonyms: | Benzeneacetonitrile, 4-amino-α-ethyl-;Indobufen Impurity 21;2-(4-aminophenyl) butyronitrile;2-(4-(3-methyl-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)phenyl)butanoic acid;Indobuprofen impurity 12 | | CAS: | 15494-55-0 | | MF: | C10H12N2 | | MW: | 160.22 | | EINECS: | | | Product Categories: | GYL | | Mol File: | 15494-55-0.mol |  |
| | Benzeneacetonitrile, 4-amino-α-ethyl- Chemical Properties |
| Boiling point | 318.3±17.0 °C(Predicted) | | density | 1.056±0.06 g/cm3(Predicted) | | pka | 4.19±0.10(Predicted) | | InChI | InChI=1S/C10H12N2/c1-2-8(7-11)9-3-5-10(12)6-4-9/h3-6,8H,2,12H2,1H3 | | InChIKey | HUNIRMUNSZPNPZ-UHFFFAOYSA-N | | SMILES | C(C1C=CC(N)=CC=1)(C#N)CC |
| | Benzeneacetonitrile, 4-amino-α-ethyl- Usage And Synthesis |
| | Benzeneacetonitrile, 4-amino-α-ethyl- Preparation Products And Raw materials |
|