2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid manufacturers
|
| | 2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid Basic information |
| Product Name: | 2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid | | Synonyms: | α-Ethyl-4-[(1,3-dihydro-1,3-dioxo-2H-isoindol)-2-yl]benzeneacetic acid;Indobufen Impurity 10;2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid;2-[4-(1,3-dioxoisoindol-2-yl)phenyl]butanoic acid;Benzeneacetic acid, 4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-α-ethyl-;Indobufen Impurity 27;Indobufen 1,?3-?Dioxo;Indobufen impurities843 | | CAS: | 94232-67-4 | | MF: | C18H15NO4 | | MW: | 309.32 | | EINECS: | 303-995-2 | | Product Categories: | | | Mol File: | 94232-67-4.mol | ![2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid Structure](CAS/GIF/94232-67-4.gif) |
| | 2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid Chemical Properties |
| Boiling point | 527.9±52.0 °C(Predicted) | | density | 1.39[at 20℃] | | vapor pressure | 0Pa at 20℃ | | pka | 4.39±0.10(Predicted) | | Water Solubility | 7.72mg/L at 20℃ | | InChI | InChI=1S/C18H15NO4/c1-2-13(18(22)23)11-7-9-12(10-8-11)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-10,13H,2H2,1H3,(H,22,23) | | InChIKey | ZQKLRJAOOUMVSA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C(N2C(=O)C3=C(C2=O)C=CC=C3)C=C1)CC | | LogP | 2.3 |
| | 2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid Usage And Synthesis |
| Uses | Indobufen 1,3-Dioxo is a derivative of Indobufen(I576500) which is a platelet aggregation inhibitor. Indobufen is the anticoagulant drug and platelet aggregation inhibitor, which has anti-inflammatory analgesic effect. Indobufen is used as an antithrombotic. | | Flammability and Explosibility | Not classified |
| | 2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid Preparation Products And Raw materials |
|