| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | tert-Butyldimethylsilyl glycidyl ether Basic information |
| | tert-Butyldimethylsilyl glycidyl ether Chemical Properties |
| Boiling point | 195-197 °C (lit.) | | density | 0.901 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.531(lit.) | | Fp | 70 °C | | InChI | 1S/C9H20O2Si/c1-9(2,3)12(4,5)11-7-8-6-10-8/h8H,6-7H2,1-5H3 | | InChIKey | YANSSVVGZPNSKD-UHFFFAOYSA-N | | SMILES | CC(C)(C)[Si](C)(C)OCC1CO1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | tert-Butyldimethylsilyl glycidyl ether Usage And Synthesis |
| Uses | tert-Butyldimethylsilyl glycidyl ether may be used to synthesize (R/S)-1-benzylamino-3-(tert-butyldimethylsilyloxy)propan-2-ol and (2R/2S)-1-(tert-butyldimethylsilyloxy)-3-{[(4S)-2,2-dimethyl-1,3-dioxolan-4-ylmethyl]amino}propan-2-ol. | | General Description | tert-Butyldimethylsilyl glycidyl ether [tert-butyl-dimethyl-(oxiran-2-ylmethoxy)silane] can be synthesized from glycidol, via hydrolytic kinetic resolution (HKR) in the presence of R-(salen)Co complex and water. |
| | tert-Butyldimethylsilyl glycidyl ether Preparation Products And Raw materials |
|