| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chlorophenoxyacetic acid Basic information |
| | 2-Chlorophenoxyacetic acid Chemical Properties |
| Melting point | 144-148 °C | | Boiling point | 266.91°C (rough estimate) | | density | 1.3245 (rough estimate) | | refractive index | 1.5250 (estimate) | | storage temp. | Store at room temperature | | form | powder to crystal | | pka | 3.05(at 25℃) | | color | White to Almost white | | Water Solubility | 1.278g/L(25 ºC) | | BRN | 1103151 | | InChI | InChI=1S/C8H7ClO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11) | | InChIKey | OPQYFNRLWBWCST-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1=CC=CC=C1Cl | | CAS DataBase Reference | 614-61-9(CAS DataBase Reference) | | NIST Chemistry Reference | (2-Chlorophenoxy)acetic acid(614-61-9) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | RTECS | AF9900000 | | HS Code | 2918.99.4700 | | HazardClass | IRRITANT | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 614-61-9(Hazardous Substances Data) |
| | 2-Chlorophenoxyacetic acid Usage And Synthesis |
| Chemical Properties | white powder |
| | 2-Chlorophenoxyacetic acid Preparation Products And Raw materials |
|