|
|
| | 1,2-Dibutyryl-sn-glycero-3-phosphocholine Basic information |
| Product Name: | 1,2-Dibutyryl-sn-glycero-3-phosphocholine | | Synonyms: | L-ALPHA-PHOSPHATIDYLCHOLINE, DIBUTYRYL;04:0 PC;1,2-DIBUTYROYL-SN-GLYCERO-3-PHOSPHOCHOLINE;1,2-DITETRANOYL-SN-GLYCERO-3-PHOSPHOCHOLINE;(7R)-4-Hydroxy-N,N,N-trimethyl-10-oxo-7-(1-oxobutoxy)-3,5,9-trioxa-4-phosphatridecan-1-aminium 4-oxide, inner salt;Dibutanoyllecithin;Dibutyryl lecithin;PC(4:0/4:0) | | CAS: | 3355-26-8 | | MF: | C16H32NO8P | | MW: | 397.4 | | EINECS: | | | Product Categories: | | | Mol File: | 3355-26-8.mol |  |
| | 1,2-Dibutyryl-sn-glycero-3-phosphocholine Chemical Properties |
| Fp | 11℃ | | storage temp. | −20°C | | form | solution | | InChI | 1S/C16H32NO8P/c1-6-8-15(18)22-12-14(25-16(19)9-7-2)13-24-26(20,21)23-11-10-17(3,4)5/h14H,6-13H2,1-5H3/t14-/m1/s1 | | InChIKey | QIJYAMAPPUXBSC-CQSZACIVSA-N | | SMILES | [O-]P(OCC[N+](C)(C)C)(OC[C@]([H])(OC(CCC)=O)COC(CCC)=O)=O |
| | 1,2-Dibutyryl-sn-glycero-3-phosphocholine Usage And Synthesis |
| Uses | 1,2-Dibutyryl-sn-glycero-3-phosphocholine is used as drug dosage forms of phenylcarbamoylaminobenzoates for enhancing cell survival rate | | Definition | ChEBI: PC(4:0/4:0) is a 1,2-diacyl-sn-glycero-3-phosphocholine. | | Biological Activity | Phosphatidylcholine (PC) functions as a surfactant within the mucus to form a hydrophobic surface to inhibit bacterial penetrance. It is used to tre at f at embolism. Phosphatidylcholine lowers the levels of cholesterol and triglycerides. |
| | 1,2-Dibutyryl-sn-glycero-3-phosphocholine Preparation Products And Raw materials |
|