|
|
| | Boc-L-cyclopropylglycine Basic information |
| Product Name: | Boc-L-cyclopropylglycine | | Synonyms: | (S)-TERT-BUTOXYCARBONYLAMINO-CYCLOPROPYL-ACETIC ACID;BOC-L-CYCLOPROPYLGLYCINE 98%;(2S)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopropylacetic acid;(S)-Amino(cyclopropyl)acetic acid, N-BOC protected;L-Cyclopropylglycine, N-BOC protected;N-tert-Butoxycarbonyl-L-cyclopropylglycine;Cyclopropaneacetic acid, .alpha.-[[(1,1-dimethylethoxy)carbonyl]amino]-, (.alpha.S)-;(2S)-[(tert-Butoxycarbonyl)amino](cyclopropyl)acetic acid | | CAS: | 155976-13-9 | | MF: | C10H17NO4 | | MW: | 215.25 | | EINECS: | | | Product Categories: | pharmacetical;Amino Acid Derivatives;a-amino;Unusual amino acids | | Mol File: | 155976-13-9.mol |  |
| | Boc-L-cyclopropylglycine Chemical Properties |
| Melting point | 79 °C | | Boiling point | 364.7±25.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Powder | | pka | 3.97±0.10(Predicted) | | color | White | | Optical Rotation | [α]/D +38±2.0°, c = 1% in ethanol | | BRN | 6650020 | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-7(8(12)13)6-4-5-6/h6-7H,4-5H2,1-3H3,(H,11,14)(H,12,13) | | InChIKey | QFVJNEASAAJIDF-ZETCQYMHSA-N | | SMILES | C1(CC1)C(C(=O)O)NC(=O)OC(C)(C)C | | CAS DataBase Reference | 155976-13-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-L-cyclopropylglycine Usage And Synthesis |
| Chemical Properties | White to yellow solid | | Uses | N-Boc-2-cyclopropyl-L-glycine is a useful synthetic compound. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-cyclopropylglycine Preparation Products And Raw materials |
|