|
|
| | norchlorpromazine Basic information |
| Product Name: | norchlorpromazine | | Synonyms: | norchlorpromazine;2-Chloro-10-[3-(methylamino)propyl]-10H-phenothiazine;Desmethylechlorpromazine;N-Methyl-2-chloro-10H-phenothiazine-10-(1-propanamine);Nor-1-chlorpromazine;10H-Phenothiazine-10-propanaMine, 2-chloro-N-Methyl-;3-(2-Chloro-10H-phenothiazin-10-yl)-N-methylpropan-1-amine;Chlorpromazine-004 | | CAS: | 1225-64-5 | | MF: | C16H17ClN2S | | MW: | 304.84 | | EINECS: | | | Product Categories: | | | Mol File: | 1225-64-5.mol |  |
| | norchlorpromazine Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C16H17ClN2S/c1-18-9-4-10-19-13-5-2-3-6-15(13)20-16-8-7-12(17)11-14(16)19/h2-3,5-8,11,18H,4,9-10H2,1H3 | | InChIKey | YHFXGBOUSIKGMZ-UHFFFAOYSA-N | | SMILES | S1c2c(cc(cc2)Cl)N(c3c1cccc3)CCCNC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | norchlorpromazine Usage And Synthesis |
| Uses | Chlorpromazine impurity D EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | | Definition | ChEBI: 3-(2-chloro-10-phenothiazinyl)-N-methyl-1-propanamine is a member of phenothiazines. |
| | norchlorpromazine Preparation Products And Raw materials |
|