| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile Basic information |
| Product Name: | 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile | | Synonyms: | 2-Hydroxy-6-thien-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile 97%;2-Hydroxy-6-thien-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile97%;2-oxo-6-thiophen-2-yl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile;2-HYDROXY-6-(2-THIENYL)-4-(TRIFLUOROMETHYL)PYRIDINE-3-CARBONITRILE;2-HYDROXY-6-(THIEN-2-YL)-4-(TRIFLUOROMETHYL)PYRIDINE-3-CARBONITRILE;3-Cyan-6-(2-thienyl)-4-trifluormethyl-2(1H)-pyridon;3-[4-(1-ethoxy-2-phenylethyl)-1-piperazinyl]-1-(4-methoxyphenyl)-1-propanol dihydrochloride;3-Pyridinecarbonitrile, 1,2-dihydro-2-oxo-6-(2-thienyl)-4-(trifluoromethyl)- | | CAS: | 3335-45-3 | | MF: | C11H5F3N2OS | | MW: | 270.23 | | EINECS: | | | Product Categories: | | | Mol File: | 3335-45-3.mol |  |
| | 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile Chemical Properties |
| Melting point | 278°C | | Boiling point | 390.2±42.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | form | solid | | pka | 5.78±0.10(Predicted) | | Sensitive | Stench | | InChI | 1S/C11H5F3N2OS/c12-11(13,14)7-4-8(9-2-1-3-18-9)16-10(17)6(7)5-15/h1-4H,(H,16,17) | | InChIKey | UBBGOCKMIMCHLZ-UHFFFAOYSA-N | | SMILES | Oc1nc(cc(c1C#N)C(F)(F)F)-c2cccs2 |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-36-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3439 | | WGK Germany | 3 | | Hazard Note | Irritant/Stench | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile Usage And Synthesis |
| Definition | ChEBI: 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile is a nitrile and a member of pyridines. |
| | 2-Hydroxy-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile Preparation Products And Raw materials |
|