| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
(Z,E)-9,12-Tetradecadienylacetate manufacturers
|
| | (Z,E)-9,12-Tetradecadienylacetate Basic information | | Toxicity |
| Product Name: | (Z,E)-9,12-Tetradecadienylacetate | | Synonyms: | CIS-9, TRANS-12-TETRADECENIAL-1-OL ACETATE;(2E,5Z)-14-Acetoxy-2,5-tetradecadiene;(9Z,12E)-9,12-Tetradecadien-1-ol acetate;Acetic acid (9Z,12E)-9,12-tetradecadienyl ester;Acetic acid [(9Z,12E)-9,12-tetradecadienyl] ester;Litlure B;trans,cis-9,12-Tetradecadienyl acetate;9,12-Tetradecadien-1-ol, 1-acetate, (9Z,12E)- | | CAS: | 30507-70-1 | | MF: | C16H28O2 | | MW: | 252.39 | | EINECS: | | | Product Categories: | | | Mol File: | 30507-70-1.mol |  |
| | (Z,E)-9,12-Tetradecadienylacetate Chemical Properties |
| Boiling point | 334.8±21.0℃ (760 Torr) | | density | 0.890±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4565 (25℃) | | Fp | 102.3±20.4℃ | | Henry's Law Constant | 1.7×10-1 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3+,7-6- | | InChIKey | ZZGJZGSVLNSDPG-FDTUMDBZSA-N | | SMILES | C(OC(=O)C)CCCCCCC/C=C\C/C=C/C | | EPA Substance Registry System | 9,12-Tetradecadien-1-ol, acetate, (9Z,12E)- (30507-70-1) |
| TSCA | TSCA listed | | Toxicity | LD50 oral in rat: > 1gm/kg |
| | (Z,E)-9,12-Tetradecadienylacetate Usage And Synthesis |
| Toxicity |
LD50 oral in rat: > 1gm/kg
| | Description | (Z,E)-9,12-TETRADECADIENYLACETATE belongs to a class of synthetic compounds called synthetic pheromones that are used as chemical signals between organisms.
| | Uses | (9Z,12E)-Tetradecadien-1-ol Acetate can be used in agricultural use and biological study for method and pesticidal mixtures for controlling Pentatomidae pests. | | Definition | ChEBI: 9Z,12E-Tetradecadienyl acetate is a carboxylic ester. | | Synthesis Reference(s) | Tetrahedron Letters, 26, p. 2769, 1985 DOI: 10.1016/S0040-4039(00)94907-4 |
| | (Z,E)-9,12-Tetradecadienylacetate Preparation Products And Raw materials |
|