| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Z-9-dodecen-1-yl acetate manufacturers
|
| | Z-9-dodecen-1-yl acetate Basic information |
| Product Name: | Z-9-dodecen-1-yl acetate | | Synonyms: | CIS-9-DODECEN-1-OL ACETATE;(9Z)-9-Dodecenyl acetate;(Z)-9-Dodecen-1-ol acetate;(z)-9-dodecenyl;(z)-9-dodecenylacetate;(z)-acetate-9-dodecen-1-ol;9-Dodecen-1-ol, acetate, (Z)-;acetate,(z)-9-dodecen-1-o | | CAS: | 16974-11-1 | | MF: | C14H26O2 | | MW: | 226.35 | | EINECS: | 241-054-7 | | Product Categories: | insect pheromone | | Mol File: | 16974-11-1.mol |  |
| | Z-9-dodecen-1-yl acetate Chemical Properties |
| Boiling point | 300.1±21.0℃ (760 Torr) | | density | 0.881±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4439 (22℃) | | Fp | 96.5±20.4℃ | | InChI | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-5H,3,6-13H2,1-2H3/b5-4- | | InChIKey | MFFQOUCMBNXSBK-PLNGDYQASA-N | | SMILES | C(OC(=O)C)CCCCCCC/C=C\CC | | LogP | 5.504 (est) | | EPA Substance Registry System | (Z)-9-Dodecen-1-ol acetate (16974-11-1) |
| TSCA | TSCA listed | | Toxicity | LD50 oral in rat: > 5gm/kg |
| | Z-9-dodecen-1-yl acetate Usage And Synthesis |
| Uses | (9Z)-Dodecen-1-ol Acetate is derived from 2-Decyn-1-ol (D228475), which is used in the synthesis of antitumor agents, isomers of Panaxytriol and Falcarinol (F101100). Also used in the synthesis of aromatase inhibitors used in the treatment of cancers, primarily breast and ovarian. | | Definition | ChEBI: 9Z-Dodecenyl acetate is a carboxylic ester. | | Biological Functions | Z-9-DODECEN-1-YL ACETATE is an insect pheromone, can be used as mating disrupter. | | Synthesis Reference(s) | Tetrahedron Letters, 21, p. 1433, 1980 DOI: 10.1016/S0040-4039(00)92738-2 |
| | Z-9-dodecen-1-yl acetate Preparation Products And Raw materials |
|