(Z)-9-Tetradecenyl acetate manufacturers
|
| | (Z)-9-Tetradecenyl acetate Basic information |
| Product Name: | (Z)-9-Tetradecenyl acetate | | Synonyms: | cis-9-Tetradecen-1-yl Acetate;Z-9-TDA;(Z)-tetradec-9-enyl acetate;cis-tetradecenyl acetate;(Z)-9-Tetradecene-1-ol acetate;Acetic acid (9Z)-9-tetradecenyl;Acetic acid (9Z)-9-tetradecenyl ester;Acetic acid (Z)-9-tetradecenyl ester | | CAS: | 16725-53-4 | | MF: | C16H30O2 | | MW: | 254.41 | | EINECS: | 240-780-1 | | Product Categories: | | | Mol File: | 16725-53-4.mol |  |
| | (Z)-9-Tetradecenyl acetate Chemical Properties |
| Melting point | 25°C (estimate) | | Boiling point | 135 °C (0.5 mmHg) | | density | 0.87 | | refractive index | 1.4455-1.4475 | | Fp | 98.5±20.4℃ | | storage temp. | -20°C | | InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h6-7H,3-5,8-15H2,1-2H3/b7-6- | | InChIKey | XXPBOEBNDHAAQH-SREVYHEPSA-N | | SMILES | C(OC(=O)C)CCCCCCC/C=C\CCCC | | LogP | 6.490 (est) | | EPA Substance Registry System | 9-Tetradecen-1-ol, acetate, (9Z)- (16725-53-4) |
| Safety Statements | 24/25 | | TSCA | TSCA listed | | HS Code | 29161900 |
| Provider | Language |
|
ACROS
| English |
| | (Z)-9-Tetradecenyl acetate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | (Z)-9-Tetradecenyl Acetate is one of the sex pheromone components of Ostrinia genus in Japan. | | Definition | ChEBI: 9Z-Tetradecenyl acetate is a carboxylic ester. | | Hazard | Low toxicity by ingestion. | | Synthesis | Synthesis of (Z)-9-Tetradecenyl Acetate, the Pheromone of the Fall Armyworm Moth from Aleuritic Acid[1].
 | | References | [1] G. B. V. SUBRAMANIAN, N. M. (1990). ChemInform Abstract: Synthesis of (Z)-9-Tetradecenyl Acetate, the Pheromone of the Fall Armyworm Moth from Aleuritic Acid. ChemInform, 21 5. https://doi.org/10.1002/chin.199005310 |
| | (Z)-9-Tetradecenyl acetate Preparation Products And Raw materials |
|