|
|
| | IRISTECTORIGENINA Basic information |
| Product Name: | IRISTECTORIGENINA | | Synonyms: | IRISTECTORIGENINA;3-[3-Hydroxy-4-methoxyphenyl]-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one;4',6-Dimethoxy-3',5,7-trihydroxyisoflavone;6,4'-Dimethoxy-5,7,3'-trihydroxyisoflavone;Iristectrigenin B;Iristetrigenin B;6,4’-Dimethoxy-5,7,3’-trihydroxyisoflavone;Modafinil acid-d 5 | | CAS: | 86849-77-6 | | MF: | C17H14O7 | | MW: | 330.29 | | EINECS: | | | Product Categories: | | | Mol File: | 86849-77-6.mol |  |
| | IRISTECTORIGENINA Chemical Properties |
| Boiling point | 621.2±55.0 °C(Predicted) | | density | 1.483±0.06 g/cm3(Predicted) | | pka | 6.43±0.20(Predicted) | | form | Solid | | color | Off-white to yellow | | InChI | InChI=1S/C17H14O7/c1-22-12-4-3-8(5-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3 | | InChIKey | WRZOUWHPDDOJNR-UHFFFAOYSA-N | | SMILES | C1OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1C1=CC=C(OC)C(O)=C1 |
| | IRISTECTORIGENINA Usage And Synthesis |
| Chemical Properties | White powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from Belamcanda chinensis. | | Uses | Iristectorigenin B (Iristectrigenin B) is a liver X receptor (LXR) modulator. Iristectrigenin B stimulates the transcriptional activity of both LXR-α and LXR-β[1]. | | References | [1] Hee-jin Jun, et al. Iristectorigenin B isolated from Belamcanda chinensis is a liver X receptor modulator that increases ABCA1 and ABCG1 expression in macrophage RAW 264.7 cells. Biotechnol Lett. 2012 Dec;34(12):2213-21. DOI:10.1007/s10529-012-1036-y |
| | IRISTECTORIGENINA Preparation Products And Raw materials |
|