- Irisflorentin
-
- $50.00
-
2026-07-15
- CAS:41743-73-1
- Purity: 99.81%
- Supply Ability: 10g
- Irisflorentin
-
-
2023-02-24
- CAS:41743-73-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Irisflorentin
-
-
2023-02-24
- CAS:41743-73-1
- Min. Order: 5mg
- Purity: Analytical Standard
- Supply Ability: 10 g
|
| | IRISFLORENTIN Basic information |
| Product Name: | IRISFLORENTIN | | Synonyms: | 3',4',5,5'-Tetramethoxy-6,7-(epoxymethanoxy)isoflavone;7-(3,4,5-Trimethoxyphenyl)-9-methoxy-8H-1,3-dioxolo[4,5-g][1]benzopyran-8-one;9-Methoxy-7-(3,4,5-trimethoxyphenyl)-8H-1,3-dioxolo[4,5-g][1]benzopyran-8-one;9-Methoxy-7-(3,4,5-trimethoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one;Irisflorentin ,98%;IRISFLORENTIN;Irisflorentin, 98%, from Blackberrylily Rhizome;Irisflorentin 41743-73-1 | | CAS: | 41743-73-1 | | MF: | C20H18O8 | | MW: | 386.35 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 41743-73-1.mol |  |
| | IRISFLORENTIN Chemical Properties |
| Melting point | 165-167 °C | | Boiling point | 569.1±50.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | DMSO : 50 mg/mL (129.42 mM; Need ultrasonic) | | form | Solid | | color | White to Almost white | | InChI | 1S/C20H18O8/c1-22-13-5-10(6-14(23-2)18(13)24-3)11-8-26-12-7-15-19(28-9-27-15)20(25-4)16(12)17(11)21/h5-8H,9H2,1-4H3 | | InChIKey | RISXUTCDCPHJFQ-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](c(c1)c4cc(c(c(c4)OC)OC)OC)=O)c(c3c(c2)OCO3)OC |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | IRISFLORENTIN Usage And Synthesis |
| Chemical Properties | Derived from the roots and rhizomes of Belamcanda chinensis | | Uses | Irisfloretin is an anti-tumor flavonoid compound extracted from Belamcanda Chinesis (L.) with anti-tumor activity. | | Definition | ChEBI: Irisflorentin is a member of 4'-methoxyisoflavones. | | IC 50 | iNOS |
| | IRISFLORENTIN Preparation Products And Raw materials |
|