|
|
| | 1,2,4-Benzenetricarboxylic acid Basic information |
| Product Name: | 1,2,4-Benzenetricarboxylic acid | | Synonyms: | 1,2,4-Benzenetricarboxylic acid,Benzene-1,2,4-tricarboxylic acid, Trimellitic acid;1-2-4-BENZENETRICARBOXYLIC ACIDCRYSTALLI NE;1,2,4-Benzenetricarboxylic acid, 98% 50GR;1,2,4-BENZENETRICARBOXYLIC ACID, 99+%;BENZENETRICARBOXYLICACID;1,2,4-BENZENETRICARBOXYLIC ACID / TRIMELLITIC ACID;Benyop- 1,2,4-Tricarboxybenzene;Benzene-1,2,4-tricarboxylic acid, Trimellitic acid | | CAS: | 528-44-9 | | MF: | C9H6O6 | | MW: | 210.14 | | EINECS: | 208-432-3 | | Product Categories: | Industrial/Fine Chemicals;MOFS COFS | | Mol File: | 528-44-9.mol |  |
| | 1,2,4-Benzenetricarboxylic acid Chemical Properties |
| Melting point | 229-231 °C (dec.) (lit.) | | Boiling point | 309.65°C (rough estimate) | | density | 1.4844 (rough estimate) | | refractive index | 1.6630 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 2.1g/l | | pka | pK1: 2.52;pK2: 3.84;pK3: 5.20 (25°C) | | form | Crystalline Powder | | color | White | | Water Solubility | 2.1 G/100 ML (25 ºC) | | Merck | 14,9702 | | BRN | 2214815 | | InChI | 1S/C9H6O6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) | | InChIKey | ARCGXLSVLAOJQL-UHFFFAOYSA-N | | SMILES | OC(C1=C(C(O)=O)C=C(C(O)=O)C=C1)=O | | LogP | 1.240 (est) | | CAS DataBase Reference | 528-44-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2,4-Benzenetricarboxylic acid(528-44-9) | | EPA Substance Registry System | 1,2,4-Benzenetricarboxylic acid (528-44-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 2 | | RTECS | DC1980000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,4-Benzenetricarboxylic acid Usage And Synthesis |
| Chemical Properties | Colorless crystals.Partially
soluble in DMF and alcohol; insoluble in benzene
and carbon disulfide; slightly soluble in water. | | Uses | 1,2,4-Benzenetricarboxylic acid (trimellitic acid) is generally used as carboxylate ligand in the synthesis of a wide range of metal-organic frameworks (MOFs). It can also be used to synthesize Ln3+ encapsulated nanocrystals which exhibit white-light luminescence. | | Uses | Intermediate in the preparation of resins, plasticizers, dyes, inks, adhesives. | | Definition | ChEBI: Benzene substituted at the 1,2, and 4 positions by carboxy groups. | | Purification Methods | Crystallise the acid from acetic acid or aqueous EtOH. [Beilstein 9 IV 3746.] |
| | 1,2,4-Benzenetricarboxylic acid Preparation Products And Raw materials |
|