| Company Name: |
Aemon Chemical |
| Tel: |
0086-755-86198205 |
| Email: |
acinfo@aemonchem.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | Triallyl trimellitate Basic information |
| Product Name: | Triallyl trimellitate | | Synonyms: | tri-2-Propenyl1,2,4-benzenetricarboxylate;triallyltrimelliate;triam705;1,2,4-Benzenetricarboxylic acid, 1,2,4-tri-2-propen-1-yl ester;N'-(4-chlorophenyl)-1-naphthalenecarboximidamide;trimelliticacidtriallylester;1,2,4-Benzenetricarboxylic acid triallyl ester~Triallyl trimellitate;benzene-1,2,4-tricarboxylic acid triallyl ester | | CAS: | 2694-54-4 | | MF: | C18H18O6 | | MW: | 330.33 | | EINECS: | 220-264-2 | | Product Categories: | | | Mol File: | 2694-54-4.mol |  |
| | Triallyl trimellitate Chemical Properties |
| Boiling point | 210°C 45mm | | density | 1.161 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.525(lit.) | | Fp | 110 °C | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 | | InChIKey | GRPURDFRFHUDSP-UHFFFAOYSA-N | | SMILES | C1(C(OCC=C)=O)=CC=C(C(OCC=C)=O)C=C1C(OCC=C)=O | | EPA Substance Registry System | Triallyl trimellitate (2694-54-4) |
| | Triallyl trimellitate Usage And Synthesis |
| Description | Triallyl trimellitate (TATM or benzene-1,2,4-tricarboxylate), a pale yellow liquid, can be used as a highly effective crosslinker due to its three allyl groups.
 | | Chemical Properties |
Triallyl trimellitate is a pale yellow liquid, it is soluble in alcohol, ether; insoluble in water.
| | Application | Triallyl trimelliate (TATM) is a Type II coagent used in peroxide curing systems, particularly for elastomers like EPDM, to enhance crosslinking density, improve mechanical properties (tensile strength and modulus), and maintain high thermal stability[2]. | | Preparation | Triallyl trimellitate is prepared by the reaction of trimellitic anhydride and allyl alcohol under a sulfuric acid catalyst. | | Hazard |
Triallyl trimellitate is harmful if swallowed, it causes skin irritation and serious eye irritation,it May also cause respiratory irritation.
| | References |
[1] J. SHIH E. O. Preparation of Triallyl Trimellitate[J]. Nippon Kagaku Kaishi, 1964, 16 1: 1910-1913. DOI:10.1246/nikkashi1898.67.11_1910.
[2] Chaudhary, B. I., Sengupta, S., Cogen, J., Curto, M. (2011). Silane grafting and moisture crosslinking of polypropylene. Polymer Engineering and Science, 1 1, 237–246. https://doi.org/10.1002/PEN.21812
|
| | Triallyl trimellitate Preparation Products And Raw materials |
|