|
|
| | cis-4-Phenylthio-L-proline hydrochloride Basic information |
| Product Name: | cis-4-Phenylthio-L-proline hydrochloride | | Synonyms: | Cis-4-Phenylthio-L-proline hydrochloride;(4S)-4-(Phenylthio)-L-proline hydrochloride;4-Phenylthio L-Proline;L-Proline,4-(phenylthio)-, hydrochloride (1:1), (4S);cis-4-Phenylthio-L-Proline HCl;(2S,4S)-4-(phenylthio)pyrrolidine-2-carboxylic acid hydrochloride;cis-4-Phenylthio-L-proline hydrochloride(Zofenopril calcium);4-Phenylthiopyrridine -2-carboxylic acid | | CAS: | 105107-84-4 | | MF: | C11H13NO2S.ClH | | MW: | 259.75 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 105107-84-4.mol |  |
| | cis-4-Phenylthio-L-proline hydrochloride Chemical Properties |
| Melting point | 151-153oC | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White | | InChI | InChI=1/C11H13NO2S.ClH/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8;/h1-5,9-10,12H,6-7H2,(H,13,14);1H/t9-,10-;/s3 | | InChIKey | XXNAGGDFBCTLQA-GQCGHMMXNA-N | | SMILES | [C@@H]1(SC2=CC=CC=C2)CN[C@H](C(=O)O)C1.Cl |&1:0,10,r| |
| | cis-4-Phenylthio-L-proline hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | (4S)-4-(Phenylthio)-L-proline is an impurity of Zofenopril (Z587000). |
| | cis-4-Phenylthio-L-proline hydrochloride Preparation Products And Raw materials |
|