| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2-(acetylamino)-5-nitrobenzoate Basic information |
| | Methyl 2-(acetylamino)-5-nitrobenzoate Chemical Properties |
| Melting point | 172.5-177.5 °C (lit.) | | InChI | InChI=1S/C10H10N2O5/c1-6(13)11-9-4-3-7(12(15)16)5-8(9)10(14)17-2/h3-5H,1-2H3,(H,11,13) | | InChIKey | HAKPLTBAUCAFMV-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=CC=C1NC(C)=O | | CAS DataBase Reference | 5409-45-0 |
| WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Methyl 2-(acetylamino)-5-nitrobenzoate Usage And Synthesis |
| Uses |
Methyl 2-(Acetylamino)-5-nitrobenzoate is used as an organic synthesis or pharmaceutical intermediate.
|
| | Methyl 2-(acetylamino)-5-nitrobenzoate Preparation Products And Raw materials |
|