| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N,N'-1,4-Phenylenedimaleimide manufacturers
|
| | N,N'-1,4-Phenylenedimaleimide Basic information |
| Product Name: | N,N'-1,4-Phenylenedimaleimide | | Synonyms: | N,N'-P-PHENYLENEDIMALEIMIDE;N,N'-1,4-BISMALEIMIDOBENZENE;n,n’-4-phenylenedimaleimide;1,4-DIMALEIMIDOBENZENE;1,4-PHENYLENE-BIS-MALEIMIDE;1,4-PDM;AKOS MSC-0043;1,4-Phenylene dimaleimide | | CAS: | 3278-31-7 | | MF: | C14H8N2O4 | | MW: | 268.22 | | EINECS: | 221-910-6 | | Product Categories: | Cross Linking Reagents;MTS & Sulfhydryl Active Reagents;Homobifunctional Crosslinker;Maleimide Derivatives;N-Substituted Maleimides;N-Substituted Maleimides, Succinimides & Phthalimides | | Mol File: | 3278-31-7.mol |  |
| | N,N'-1,4-Phenylenedimaleimide Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 411.39°C (rough estimate) | | density | 1.3140 (rough estimate) | | refractive index | 1.5910 (estimate) | | storage temp. | Poison room | | solubility | DMSO, Methanol (Very Slightly) | | form | Solid | | pka | -1.81±0.20(Predicted) | | color | Yellow | | BRN | 249631 | | InChI | 1S/C14H8N2O4/c17-11-5-6-12(18)15(11)9-1-2-10(4-3-9)16-13(19)7-8-14(16)20/h1-8H | | InChIKey | AQGZJQNZNONGKY-UHFFFAOYSA-N | | SMILES | O=C1C=CC(=O)N1c2ccc(cc2)N3C(=O)C=CC3=O | | CAS DataBase Reference | 3278-31-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 45-38-36/37/39-28A | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29251995 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N,N'-1,4-Phenylenedimaleimide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A short, sulfhydryl reactive hmombifunctional crosslinking reagent for protein crosslinking. |
| | N,N'-1,4-Phenylenedimaleimide Preparation Products And Raw materials |
|