|
|
| | 3-Hydroxy-2-pyridinemethanol hydrochloride Basic information |
| | 3-Hydroxy-2-pyridinemethanol hydrochloride Chemical Properties |
| Melting point | 217 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | color | Brown | | InChI | InChI=1S/C6H7NO2.ClH/c8-4-5-6(9)2-1-3-7-5;/h1-3,8-9H,4H2;1H | | InChIKey | SKVRYQUMKJQZFN-UHFFFAOYSA-N | | SMILES | C1(CO)=NC=CC=C1O.Cl | | CAS DataBase Reference | 14173-30-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-27-36/37/39 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Hydroxy-2-pyridinemethanol hydrochloride Usage And Synthesis |
| | 3-Hydroxy-2-pyridinemethanol hydrochloride Preparation Products And Raw materials |
|