2-METHYL-2-PROPAN-D9-OL manufacturers
- 2-METHYL-2-PROPAN-D9-OL
-
- $10.00 / 1kg
-
2022-03-22
- CAS:25725-11-5
- Min. Order: 1kg
- Purity: >99%
- Supply Ability: 10 tons
|
| | 2-METHYL-2-PROPAN-D9-OL Basic information |
| Product Name: | 2-METHYL-2-PROPAN-D9-OL | | Synonyms: | 2-METHYL-2-PROPAN-D9-OL;2-(Methyl-d3)-2-propan-d6-ol;2-Propan-1,1,1,3,3,3-d6-ol,2-(methyl-d3)-;2-Methyl-2-propan-d9-ol, tert-Butyl-d9 alcohol;tert-Butan-d9-ol;TERT-BUTYL-D9 ALCOHOL;TERT-BUTANOL (D9);TERT-BUTANOL-D9,OH | | CAS: | 25725-11-5 | | MF: | C4HD9O | | MW: | 83.18 | | EINECS: | | | Product Categories: | | | Mol File: | 25725-11-5.mol |  |
| | 2-METHYL-2-PROPAN-D9-OL Chemical Properties |
| Melting point | 23-26 °C(lit.) | | Boiling point | 83 °C(lit.) | | density | 0.868 g/mL at 25 °C | | Fp | 11 °C | | InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1D3,2D3,3D3 | | InChIKey | DKGAVHZHDRPRBM-GQALSZNTSA-N | | SMILES | C(O)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 75-65-0 |
| | 2-METHYL-2-PROPAN-D9-OL Usage And Synthesis |
| Uses | tert-Butyl-d9 Alcohol (CAS# 25725-11-5) is a useful isotopically labeled research compound. |
| | 2-METHYL-2-PROPAN-D9-OL Preparation Products And Raw materials |
|