|
|
| | TERT-BUTANOL-D10 Basic information |
| | TERT-BUTANOL-D10 Chemical Properties |
| Boiling point | 82 °C(lit.) | | density | 0.893 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3835(lit.) | | Fp | 52 °F | | storage temp. | Flammables area | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Liquid | | color | Colourless | | Major Application | pharmaceutical | | InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1D3,2D3,3D3,5D | | InChIKey | DKGAVHZHDRPRBM-SGLLWXCUSA-N | | SMILES | C(O[2H])(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] | | EPA Substance Registry System | 2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)- (53001-22-2) | | CAS Number Unlabeled | 75-65-0 |
| Hazard Codes | F,Xn | | Risk Statements | 11-20-36/37 | | Safety Statements | 9-16-46 | | RIDADR | UN 1120 3/PG 2 | | WGK Germany | 3 | | HazardClass | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | TERT-BUTANOL-D10 Usage And Synthesis |
| Chemical Properties | TERT-BUTANOL-D10 is clear colorless liquid | | Uses | TERT-BUTANOL-D10 is used as an internal standard for the quantification of Tert-butanol by GC- or LC-mass spectrometry | | Uses | tert-Butanol-d10 may be used in the synthesis of cyanoacetic acid-tert-butylester-d9 and tert-butoxide-d9 (BuOK-d9). | | General Description | tert-Butanol-d10 (tert-Butyl alcohol-d10) is a deuterated derivative of tert-butanol. It participates in the synthesis of cyanoacetic acid-tert-butylester-d9. Conformational analysis of 2,3-dihydroxypropanoic acid in tert-butyl alcohol-d10 indicates the dominance of gauche-hydroxyl rotamers (92%) under low pH conditions. |
| | TERT-BUTANOL-D10 Preparation Products And Raw materials |
|