| Company Name: |
Aromsyn Co., Ltd. |
| Tel: |
+86-0571-85585865 +8613336024896 |
| Email: |
CB@aromsyn.com |
| Products Intro: |
Product Name:18-Vinyl-2,3,5,6,8,9,11,12,14,15-decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecine
CAS:39557-71-6
Purity:NLT 97% Package:1G;1KG;100KG Remarks:AS97276
|
|
|
|
|
| Company Name: |
Guangzhou CATO Research Chemicals Inc. |
| Tel: |
+86-020-81960175-617 +8615602392859 |
| Email: |
Intermediate@cato-chem.com |
| Products Intro: |
Product Name:18-Vinyl-2,3,5,6,8,9,11,12,14,15-decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecine
CAS:39557-71-6
Purity:0.99 Package:25MG;50MG;100MG;5KG;1KG
|
|
|
|
|
|
| | 4-Vinylbenzo-18-crown-6 Basic information |
| Product Name: | 4-Vinylbenzo-18-crown-6 | | Synonyms: | 4'-VINYLBENZO-18-CROWN-6;4-VINYLBENZO-18-CROWN-6;18-ETHENYL-2,3,5,6,8,9,11,12,14,15-DECAHYDRO-1,4,7,10,13,16-BENZO-HEXAOXACYCLOOCTADECIN;4-VINYLBENZO-18-CROWN-6 97%;4-Vinylbenzo-18-crown-6,97%;18-Vinyl-2,3,5,6,8,9,11,12,14,15-decahydrobenzo-[b][1,4,7,10,13,16]hexaoxacyclooctadecine;1,4,7,10,13,16-Benzohexaoxacyclooctadecin, 18-ethenyl-2,3,5,6,8,9,11,12,14,15-decahydro- | | CAS: | 39557-71-6 | | MF: | C18H26O6 | | MW: | 338.4 | | EINECS: | | | Product Categories: | Chelation/Complexation Compounds;Crown Ethers;Synthetic Reagents | | Mol File: | 39557-71-6.mol |  |
| | 4-Vinylbenzo-18-crown-6 Chemical Properties |
| Melting point | 56-60 °C | | Boiling point | 434.54°C (rough estimate) | | density | 1.1634 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,2-8°C | | form | Crystalline Powder | | color | Off-white | | InChI | InChI=1S/C18H26O6/c1-2-16-3-4-17-18(15-16)24-14-12-22-10-8-20-6-5-19-7-9-21-11-13-23-17/h2-4,15H,1,5-14H2 | | InChIKey | WMBFARVSOWVDII-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(C=C)C=C2OCCOCCOCCOCCOCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 29329900 |
| | 4-Vinylbenzo-18-crown-6 Usage And Synthesis |
| Chemical Properties | off-white crystalline powder |
| | 4-Vinylbenzo-18-crown-6 Preparation Products And Raw materials |
|