|
|
| | Methyl tributyl ammonium chloride Basic information |
| Product Name: | Methyl tributyl ammonium chloride | | Synonyms: | Tributylmethylammonium chloride >=98.0% (T);[P3C1N]Cl;METHYL TRIBUTYL AMMONIUM CHLORIDE & 75% H2O SOLUTION;Methyl tributyl ammonium chloride in 75% H2O Solution;METHYL TRIBUTYL AMMONIUM CHLORIDE & 75% H2O SOLUTION MTBAC;TRIBUTYLAMMONIOMETHYL-POLYSTYRENE CROSSLINKED WITH DIVINYLBE;ALIQUAT(R) 175;ALIQUAT 175 | | CAS: | 56375-79-2 | | MF: | C13H30ClN | | MW: | 235.84 | | EINECS: | 260-135-8 | | Product Categories: | bc0001;33 | | Mol File: | 56375-79-2.mol |  |
| | Methyl tributyl ammonium chloride Chemical Properties |
| Melting point | 95-99 °C | | Boiling point | 84-85°C 101mm | | density | 0,964 g/cm3 | | vapor pressure | 7.9 mmHg ( 25 °C) | | refractive index | n20/D 1.4682 | | Fp | 84-85°C/101mm | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Light orange to Yellow to Green | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 6300212 | | InChI | 1S/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1 | | InChIKey | IPILPUZVTYHGIL-UHFFFAOYSA-M | | SMILES | [Cl-].CCCC[N+](C)(CCCC)CCCC | | LogP | -2--0.842 at 20-25℃ | | CAS DataBase Reference | 56375-79-2(CAS DataBase Reference) | | EPA Substance Registry System | 1-Butanaminium, N,N-dibutyl-N-methyl-, chloride (56375-79-2) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22-36-20/21/22 | | Safety Statements | 26-37/39-36/37/39-36/37 | | RIDADR | 2810 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29211990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2 |
| | Methyl tributyl ammonium chloride Usage And Synthesis |
| Chemical Properties | Slightly pale yellow crystalline powder | | Uses | Tributylmethylammonium chloride solution is used as a phase transfer catalyst in the synthesis of ɛ-caprolactone by Baeyer-Villiger oxidation of cyclohexanone in the presence of KHSO5 as an oxidizing agent. |
| | Methyl tributyl ammonium chloride Preparation Products And Raw materials |
|