|
|
| | Benzyltributylammonium chloride Basic information |
| | Benzyltributylammonium chloride Chemical Properties |
| Melting point | 155-163 °C (lit.) | | Boiling point | 466.93°C (rough estimate) | | density | 0.9523 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | White to ivory | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 3776210 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C19H34N.ClH/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;/h10-14H,4-9,15-18H2,1-3H3;1H/q+1;/p-1 | | InChIKey | VJGNLOIQCWLBJR-UHFFFAOYSA-M | | SMILES | [N+](CCCC)(CCCC)(CCCC)CC1=CC=CC=C1.[Cl-] | | CAS DataBase Reference | 23616-79-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenemethanaminium, N,N,N-tributyl-, chloride (23616-79-7) |
| | Benzyltributylammonium chloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Benzyltributylammonium chloride is used:- As a hydrogen bond acceptor (HBAs) in the synthesis of new series of deep eutectic solvents (DESs) with common hydrogen bond donors.
- As a cationic surfactant to study the interactions with anionic dyes such as indigo carmine (IC) and amaranth (Amr)by conductometric method.
|
| | Benzyltributylammonium chloride Preparation Products And Raw materials |
|