|
|
| | Benzyltributylammonium bromide Basic information |
| | Benzyltributylammonium bromide Chemical Properties |
| Melting point | 169-175 °C | | density | 1.1791 (rough estimate) | | refractive index | 1.5260 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to off-white | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 3776294 | | InChI | InChI=1S/C19H34N.BrH/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;/h10-14H,4-9,15-18H2,1-3H3;1H/q+1;/p-1 | | InChIKey | UDYGXWPMSJPFDG-UHFFFAOYSA-M | | SMILES | [N+](CCCC)(CCCC)(CCCC)CC1=CC=CC=C1.[Br-] | | CAS DataBase Reference | 25316-59-0(CAS DataBase Reference) |
| | Benzyltributylammonium bromide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Benzyltributylammonium bromide can be used:
- As a phase transfer catalyst in the isomerization reactions of cis-4-formyl-2-azetidinones.
- As a hydrogen-bondacceptor in the preparation of deep eutectic solvents, which are used in the isolation of lysozyme from the chicken egg white.
- In the phase transfer glycosylation ofnovobiocin to yield glucosyl-novobiocin.
|
| | Benzyltributylammonium bromide Preparation Products And Raw materials |
|