| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Lys-Lys-Lys-Lys-Lys Basic information |
| Product Name: | Lys-Lys-Lys-Lys-Lys | | Synonyms: | Lys5;5-mer polyLys PO00002137-02;L-Lysine,L-lysyl-L-lysyl-L-lysyl-L-lysyl-;Lys-Lys-Lys-Lys-Lys >=55% peptide basis;L-Lysyl-L-lysyl-L-lysyl-L-lysyl-L-lysine;pentalysine;Lys-Lys-Lys-Lys-Lys | | CAS: | 19431-21-1 | | MF: | C30H62N10O6 | | MW: | 658.88 | | EINECS: | | | Product Categories: | | | Mol File: | 19431-21-1.mol |  |
| | Lys-Lys-Lys-Lys-Lys Chemical Properties |
| Boiling point | 1037.5±65.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.27±0.10(Predicted) | | form | powder | | color | white | | Sequence | Lys-Lys-Lys-Lys-Lys | | InChIKey | IXPHOHNWDLRFJH-UHFFFAOYSA-N | | SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Lys-Lys-Lys-Lys-Lys Usage And Synthesis |
| Uses | Penta lysine is an antibacterial agent, that inhibits E. coli, A. baumannii, P. aeruginos, S. aureus, and B. subtilis, with MIC of 1.1-18 μM[1]. | | Biochem/physiol Actions | Short poly-L-lysines polypeptides such as trilysine (lys3), tetralysine (tetra-L-lysine, lys4) and pentalysine (penta-L-lysine, lys5) are cationic moieties that may be used in the construction of gene delivery vectors and DNA nanoparticles. | | References | [1] Albada HB, et al., Short antibacterial peptides with significantly reduced hemolytic activity can be identified by a systematic L-to-D exchange scan of their amino acid residues. ACS Comb Sci. 2013 Nov 11;15(11):585-92. DOI:10.1021/co400072q |
| | Lys-Lys-Lys-Lys-Lys Preparation Products And Raw materials |
|