LYS-LYS-LYS-LYS manufacturers
- Tetralysine
-
- $3100.00
-
2026-04-22
- CAS:997-20-6
- Purity:
- Supply Ability: 10g
|
| | LYS-LYS-LYS-LYS Basic information |
| Product Name: | LYS-LYS-LYS-LYS | | Synonyms: | LYS-LYS-LYS-LYS;tetralysine;Lys-Lys-Lys-Lys,Tetralysine;Lys4;lysine tetrapeptide;Lys-Lys-Lys-Lys >=95% (TLC);LYS-LYS-LYS-LYS USP/EP/BP;L-Lysine, L-lysyl-L-lysyl-L-lysyl- | | CAS: | 997-20-6 | | MF: | C24H50N8O5 | | MW: | 530.7 | | EINECS: | | | Product Categories: | | | Mol File: | 997-20-6.mol |  |
| | LYS-LYS-LYS-LYS Chemical Properties |
| Boiling point | 901.2±65.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 3.27±0.10(Predicted) | | form | powder or crystals | | color | white | | Sequence | Lys-Lys-Lys-Lys | | InChIKey | RRBGTUQJDFBWNN-UHFFFAOYSA-N | | SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | LYS-LYS-LYS-LYS Usage And Synthesis |
| Uses | Tetralysine is a cationic moietie that may be used in the construction of gene delivery vectors and DNA nanoparticles[1]. | | Biological Activity | Short poly-L-lysines polypeptides such as trilysine (lys3), tetralysine (tetra-L-lysine, lys4) and pentalysine (penta-L-lysine, lys5) are cationic moieties th at may be used in the construction of gene delivery vectors and DNA nanoparticles. | | References | [1] J H Kleinschmidt, et al. Spin-Label Electron Spin Resonance Studies on the Interactions of
Lysine Peptides with Phospholipid Membranes. Biophys J. 1997 Nov;73(5):2546-55. DOI:10.1016/S0006-3495(97)78283-3 |
| | LYS-LYS-LYS-LYS Preparation Products And Raw materials |
|