- LYS-LYS-LYS
-
- $3.00
-
2019-07-12
- CAS:13184-14-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | Lys-Lys-Lys Basic information |
| Product Name: | Lys-Lys-Lys | | Synonyms: | trilysine;(S)-6-amino-2-((S)-6-amino-2-((S)-2,6-diaminohexanamido)hexanamido)hexanoic acid;REF DUPL: H-Lys-Lys-Lys-OH;12: PN: WO2010059829 SEQID;L-Lysyl-L-lysyl-L-lysine;3-mer polyLys|H-Lys-Lys-Lys-OH;Lys-Lys-Lys-OH·AcOH≥ 97% (HPLC);H-LYS-LYS-LYS-LYS-OH ACETATE SALT | | CAS: | 13184-14-0 | | MF: | C18H38N6O4 | | MW: | 402.53 | | EINECS: | | | Product Categories: | | | Mol File: | 13184-14-0.mol |  |
| | Lys-Lys-Lys Chemical Properties |
| Boiling point | 745.4±60.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | pK1:3.08(+2);pK2:7.34(+1);pK3:9.80(0) ;pK4:10.54(-1) (25°C,μ=0.1) | | form | powder | | color | white to off-white | | InChI | 1S/C18H38N6O4/c19-10-4-1-7-13(22)16(25)23-14(8-2-5-11-20)17(26)24-15(18(27)28)9-3-6-12-21/h13-15H,1-12,19-22H2,(H,23,25)(H,24,26)(H,27,28) | | InChIKey | WBSCNDJQPKSPII-KKUMJFAQSA-N | | SMILES | C(O)(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)N |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Lys-Lys-Lys Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Short poly-L-lysines polypeptides such as trilysine (tri-L-lysine, lys3); tetralysine (tetra-L-lysine, lys4) and pentalysine (penta-L-lysine, lys5) are cationic moieties th at may be used in the construction of gene delivery vectors and DNA nanoparticles. | | Definition | ChEBI: Lys-Lys-Lys is an oligopeptide. |
| | Lys-Lys-Lys Preparation Products And Raw materials |
|