|
|
| | 2-Bromo-5-chlorophenylacetic acid Basic information |
| Product Name: | 2-Bromo-5-chlorophenylacetic acid | | Synonyms: | 2-BROMO-5-CHLOROPHENYLACETIC ACID;Fs011376;2-Bromo-5-chlorophenylacetic acidSEE B2582-D;2-(2-broMo-5-chlorophenyl)acetic acid;(2-Bromo-5-chlorophenyl)acetic acid, 2-(2-Bromo-5-chlorophenyl)ethanoic acid;Benzeneacetic acid, 2-bromo-5-chloro-;2-Bromo-5-chlorophenylacetic aci;2-Bromo-5-chlorobenzeneacetic acid | | CAS: | 81682-38-4 | | MF: | C8H6BrClO2 | | MW: | 249.49 | | EINECS: | | | Product Categories: | | | Mol File: | 81682-38-4.mol |  |
| | 2-Bromo-5-chlorophenylacetic acid Chemical Properties |
| Melting point | 101-103°C | | Boiling point | 345.6±27.0 °C(Predicted) | | density | 1.720±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.87±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H6BrClO2/c9-7-2-1-6(10)3-5(7)4-8(11)12/h1-3H,4H2,(H,11,12) | | InChIKey | ZPSZXWVBMOMXED-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(Cl)=CC=C1Br | | CAS DataBase Reference | 81682-38-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2916399090 |
| | 2-Bromo-5-chlorophenylacetic acid Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder | | Uses | 2-Bromo-5-chlorophenylacetic acid is used as a pharmaceutical intermediate. |
| | 2-Bromo-5-chlorophenylacetic acid Preparation Products And Raw materials |
|