|
|
| | Ethyl imidazole-4-carboxylate Basic information |
| | Ethyl imidazole-4-carboxylate Chemical Properties |
| Melting point | 160-162 | | Boiling point | 319.5±15.0 °C(Predicted) | | density | 1.214±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.04±0.10(Predicted) | | color | White | | Water Solubility | Soluble in dimethyl sulfoxide and methanol. Slightly soluble in water. | | λmax | 234nm(CH3CN)(lit.) | | InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-3-7-4-8-5/h3-4H,2H2,1H3,(H,7,8) | | InChIKey | KLWYPRNPRNPORS-UHFFFAOYSA-N | | SMILES | C1NC(C(OCC)=O)=CN=1 | | CAS DataBase Reference | 23785-21-9 |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | Ethyl imidazole-4-carboxylate Usage And Synthesis |
| Chemical Properties | White to light yellow crystal, powder or crystalline powder | | Uses | A ring-substituted-1H-imidazole-4-carboxylic acid derivative, that is shown to act as a new class of anti-tuberculosis agents. |
| | Ethyl imidazole-4-carboxylate Preparation Products And Raw materials |
|