|
|
| | DU 6856 Basic information |
| Product Name: | DU 6856 | | Synonyms: | 7-[(7S)-7-Amino-5-azaspiro[2.4]hept-5-yl]-8-chloro-6-fluoro-1-[(1S,2R)-2-fluorocyclopropyl]-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid;DU 6856;SitafloxacinisomerⅠ(SSR);sitafloxacin isomer I(SSR);3-Quinolinecarboxylic acid, 7-[(7S)-7-aMino-5-azaspiro[2.4]hept-5-yl]-8-chloro-6-fluoro-1-[(1S,2R)-2-fluorocyclopropyl]-1,4-dihydro-4-oxo-;Sitafloxacin Isomer Impurity 1;Sitafloxacin Impurity 23;sitafloxacin hydrate Impurity 23 | | CAS: | 127254-11-9 | | MF: | C19H18ClF2N3O3 | | MW: | 409.81 | | EINECS: | | | Product Categories: | | | Mol File: | 127254-11-9.mol |  |
| | DU 6856 Chemical Properties |
| Boiling point | 629.2±55.0 °C(Predicted) | | density | 1.63 | | pka | 6.39±0.50(Predicted) | | InChIKey | PNUZDKCDAWUEGK-KGYLQXTDSA-N | | SMILES | N1([C@H]2C[C@H]2F)C2=C(C=C(F)C(N3C[C@@H](N)C4(CC4)C3)=C2Cl)C(=O)C(C(O)=O)=C1 |
| | DU 6856 Usage And Synthesis |
| Uses | DU 6856, is an isomer of Sitafloxacin (S490920), which is an antibacterial. |
| | DU 6856 Preparation Products And Raw materials |
|