|
|
| | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate Basic information |
| Product Name: | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate | | Synonyms: | Ethyl 2-(3-chloro-2,4,5-trifluorobenzoyl)acetate;Ethyl 3-chloro-2,4,5-trifluorobenzoylacetate;Benzenepropanoic acid,3-chloro-2,4,5-trifluoro-b-oxo-, ethyl ester;"3-(3-Chloro-2,4,5-trifluoro-phenyl)-3-oxo- propionic acid ethyl ester ";ethyl beta-(3-chloro-2,4,5-trifluorophenyl)-beta-oxopropionate;3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoic acid;Intermediate Of Sitafloxacin;Benzenepropanoic acid, 3-chloro-2,4,5-trifluoro-β-oxo-, ethyl ester | | CAS: | 101987-86-4 | | MF: | C11H8ClF3O3 | | MW: | 280.63 | | EINECS: | 1806241-263-5 | | Product Categories: | | | Mol File: | 101987-86-4.mol |  |
| | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate Chemical Properties |
| Melting point | 80-83℃ | | Boiling point | 325℃ | | density | 1.413 | | Fp | 130℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.32±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H8ClF3O3/c1-2-18-8(17)4-7(16)5-3-6(13)11(15)9(12)10(5)14/h3H,2,4H2,1H3 | | InChIKey | LZMXLCPYJNRWNQ-UHFFFAOYSA-N | | SMILES | C1(=CC(F)=C(F)C(Cl)=C1F)C(=O)CC(OCC)=O |
| | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate Usage And Synthesis |
| Chemical Properties | off-white solid | | Uses | Ethyl 3-(3-Chloro-2,4,5-trifluorophenyl)-3-oxopropanoate is a reagent used in the preparation of fluoroquinolone derivatives as antibacterial and antimycobacterial agents. |
| | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate Preparation Products And Raw materials |
|