|
|
| | 2'-O-(2-Methoxyethyl)uridine Basic information |
| Product Name: | 2'-O-(2-Methoxyethyl)uridine | | Synonyms: | 2'-O-MOE Uridine;2'-O-(2-Methoxyethyl)uridine;2'-O-(2-Methoxyethy)uridine;1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione;2'-O-(2-Methoxyethyl)-uridine, >97%;1-[(2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)tetrahydrofuran-2-yl]pyrimidine-2,4-dione;Uridine, 2'-O-(2-methoxyethyl)-;2'-O-MOE-rU | | CAS: | 223777-15-9 | | MF: | C12H18N2O7 | | MW: | 302.28 | | EINECS: | | | Product Categories: | Bases & Related Reagents;Carbohydrates & Derivatives;Heterocycles;Nucleotides | | Mol File: | 223777-15-9.mol |  |
| | 2'-O-(2-Methoxyethyl)uridine Chemical Properties |
| density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | pka | 9.39±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C12H18N2O7/c1-19-4-5-20-10-9(17)7(6-15)21-11(10)14-3-2-8(16)13-12(14)18/h2-3,7,9-11,15,17H,4-6H2,1H3,(H,13,16,18)/t7-,9-,10-,11-/m1/s1 | | InChIKey | XTXNROBDOKPICP-QCNRFFRDSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](OCCOC)[C@@H]1O |
| | 2'-O-(2-Methoxyethyl)uridine Usage And Synthesis |
| Uses | A uridine derivative as building blocks for cross-linking oligonucleotides. | | Uses | 2'-O-(2-Methoxyethyl)uridine is a Uridine (U829910) derivative as building blocks for cross-linking oligonucleotides. | | Uses | 2''-O-(2-Methoxyethyl)uridine is a Uridine (U829910) derivative as building blocks for cross-linking oligonucleotides. |
| | 2'-O-(2-Methoxyethyl)uridine Preparation Products And Raw materials |
|