| Company Name: |
RSJ Biotech Ltd. Gold |
| Tel: |
189-13120456 13962152618 |
| Email: |
182250405@qq.com |
(1S,2S)-2-(benzylamino)cyclopentanol manufacturers
|
| | (1S,2S)-2-(benzylamino)cyclopentanol Basic information |
| Product Name: | (1S,2S)-2-(benzylamino)cyclopentanol | | Synonyms: | (1S,2S)-2-[(Phenylmethyl)amino]cyclopentanol,99%e.e.;(1S,2S)-2-(benzylamino)cyclopentanol;(1S,2S)-2-(benzylamino)cyclopentan-1-ol;Trans-(1S,2S)-2-Benzylaminocyclopentanol Hydrochloride;(1S,2S)-trans-2-(N-benzyl)amino-1-cyclopentanol | | CAS: | 68327-02-6 | | MF: | C12H17NO | | MW: | 191 | | EINECS: | | | Product Categories: | apis | | Mol File: | 68327-02-6.mol |  |
| | (1S,2S)-2-(benzylamino)cyclopentanol Chemical Properties |
| Melting point | 79℃ | | storage temp. | 2-8°C | | form | solid | | color | white | | InChI | InChI=1/C12H17NO/c14-12-8-4-7-11(12)13-9-10-5-2-1-3-6-10/h1-3,5-6,11-14H,4,7-9H2/t11-,12-/s3 | | InChIKey | FEGVMDAESGIXLU-KBLMMMSONA-N | | SMILES | [C@H]1(O)CCC[C@@H]1NCC1=CC=CC=C1 |&1:0,5,r| |
| | (1S,2S)-2-(benzylamino)cyclopentanol Usage And Synthesis |
| | (1S,2S)-2-(benzylamino)cyclopentanol Preparation Products And Raw materials |
|