| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(1S,2S)-trans-N-Boc-2-aminocyclopentanol manufacturers
|
| | (1S,2S)-trans-N-Boc-2-aminocyclopentanol Basic information |
| Product Name: | (1S,2S)-trans-N-Boc-2-aminocyclopentanol | | Synonyms: | (1S,2S)-trans-N-Boc-2-aminocyclopentanol;tert-butyl (1S,2S)-2-hydroxycyclopentylcarbamate;((1S,2S)-2-Hydroxycyclopentyl)carbamic acid tert-butyl ester;tert-Butyl N-((2S,1S)-2-hydroxycyclopentyl)carbamate;(1S,2S)-trans-N-Boc-2-aminocyclopentanol 99%;(1S,2S)-2-(Boc-amino)cyclopentanol;Carbamic acid,N-[(1S,2S)-2-hydroxycyclopentyl]-, 1,1-dimethylethyl ester;tert-butyl (1S,2S)-2-hydroxycyclopentyl | | CAS: | 145106-43-0 | | MF: | C10H19NO3 | | MW: | 201.26 | | EINECS: | | | Product Categories: | apis;Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 145106-43-0.mol |  |
| | (1S,2S)-trans-N-Boc-2-aminocyclopentanol Chemical Properties |
| Melting point | 87.0℃ | | Boiling point | 320.8±31.0 °C(Predicted) | | density | 1.08±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.09±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | -23.2° (C=0.93 g/100ml CH2CL2) | | BRN | 5810036 | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-7-5-4-6-8(7)12/h7-8,12H,4-6H2,1-3H3,(H,11,13)/t7-,8-/m0/s1 | | InChIKey | CGZQRJSADXRRKN-YUMQZZPRSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCC[C@@H]1O |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | (1S,2S)-trans-N-Boc-2-aminocyclopentanol Usage And Synthesis |
| Uses | Reactant for:
- Asymmetric synthesis of constrained (-)-S-adenosyl-L-homocysteine (SAH) analogs as DNA methyltransferase inhibitors via stereoselective thioesterification, thioetherification, hydrolysis, heterocyclization and amination
|
| | (1S,2S)-trans-N-Boc-2-aminocyclopentanol Preparation Products And Raw materials |
|