| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 4-Deschloro-4-(2-furanylMethyl)aMino FuroseMide Basic information |
| | 4-Deschloro-4-(2-furanylMethyl)aMino FuroseMide Chemical Properties |
| Melting point | 217℃ (decomposition) (ethanol ) | | Boiling point | 643.4±65.0 °C(Predicted) | | density | 1.524±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.75±0.36(Predicted) | | color | White to Dark Brown | | InChI | InChI=1S/C17H17N3O6S/c18-27(23,24)16-7-13(17(21)22)14(19-9-11-3-1-5-25-11)8-15(16)20-10-12-4-2-6-26-12/h1-8,19-20H,9-10H2,(H,21,22)(H2,18,23,24) | | InChIKey | NQRLIXFNJZQNKV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(N)(=O)=O)=C(NCC2=CC=CO2)C=C1NCC1=CC=CO1 |
| | 4-Deschloro-4-(2-furanylMethyl)aMino FuroseMide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 4-Deschloro-4-(2-furanylmethyl)amino Furosemide (Furosemide EP Impurity D) is a Furosemide (F865000) Impurity. |
| | 4-Deschloro-4-(2-furanylMethyl)aMino FuroseMide Preparation Products And Raw materials |
|