| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Fluorobiphenyl-4-carboxylic Acid Basic information |
| | 2-Fluorobiphenyl-4-carboxylic Acid Chemical Properties |
| Melting point | 223-227 °C (lit.) | | Boiling point | 361.6±30.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.85±0.10(Predicted) | | color | White to Off-White | | InChI | 1S/C13H9FO2/c14-12-8-10(13(15)16)6-7-11(12)9-4-2-1-3-5-9/h1-8H,(H,15,16) | | InChIKey | PFKITESTTSWHMP-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(c(F)c1)-c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluorobiphenyl-4-carboxylic Acid Usage And Synthesis |
| Uses | 2-Fluorobiphenyl-4-carboxylic Acid is an impurity of Flurbiprofen (F598700), an anti-inflammatory used as an analgesic. Flurbiprofen impurity E. |
| | 2-Fluorobiphenyl-4-carboxylic Acid Preparation Products And Raw materials |
|